C25H36N2O2S — CID 57471374
N-[3-[8-benzyl-7-(ethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide (PubChem CID 57471374) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is N-[3-[8-benzyl-7-(ethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide.
| Compound Name | N-[3-[8-benzyl-7-(ethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 57471374 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-[3-[8-benzyl-7-(ethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCCc1ccc2c(c1)C(Cc1ccccc1)C(NCC)CC2 |
| InChI | InChI=1S/C25H36N2O2S/c1-3-17-30(28,29)27-16-8-11-21-12-13-22-14-15-25(26-4-2)24(23(22)18-21)19-20-9-6-5-7-10-20/h5-7,9-10,12-13,18,24-27H,3-4,8,11,14-17,19H2,1-2H3 |
| InChIKey | KQCCVDFBLRKHGL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|