C39H30Cl2O6P2 — CID 57471770
methyl 2-[6-chloro-2-(3-chloro-6-diphenylphosphoryl-2-hydroxyphenyl)-3-diphenylphosphorylphenoxy]acetate (PubChem CID 57471770) has the molecular formula C39H30Cl2O6P2 and a molecular weight of 727.52 g/mol. Its IUPAC name is methyl 2-[6-chloro-2-(3-chloro-6-diphenylphosphoryl-2-hydroxyphenyl)-3-diphenylphosphorylphenoxy]acetate.
| Compound Name | methyl 2-[6-chloro-2-(3-chloro-6-diphenylphosphoryl-2-hydroxyphenyl)-3-diphenylphosphorylphenoxy]acetate |
|---|---|
| PubChem CID | 57471770 |
| Molecular Formula | C39H30Cl2O6P2 |
| Molecular Weight | 727.52 g/mol |
| Exact Mass | 726.09 |
| IUPAC Name | methyl 2-[6-chloro-2-(3-chloro-6-diphenylphosphoryl-2-hydroxyphenyl)-3-diphenylphosphorylphenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)ccc(P(=O)(c2ccccc2)c2ccccc2)c1-c1c(P(=O)(c2ccccc2)c2ccccc2)ccc(Cl)c1O |
| InChI | InChI=1S/C39H30Cl2O6P2/c1-46-35(42)26-47-39-32(41)23-25-34(49(45,29-18-10-4-11-19-29)30-20-12-5-13-21-30)37(39)36-33(24-22-31(40)38(36)43)48(44,27-14-6-2-7-15-27)28-16-8-3-9-17-28/h2-25,43H,26H2,1H3 |
| InChIKey | OBOSPIAQEKPEFD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|