C27H26N6O4S — CID 57481642
tert-butyl 4-[4-[2,5-dioxo-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrol-3-yl]quinazolin-2-yl]piperazine-1-carboxylate (PubChem CID 57481642) has the molecular formula C27H26N6O4S and a molecular weight of 530.61 g/mol. Its IUPAC name is tert-butyl 4-[4-[2,5-dioxo-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrol-3-yl]quinazolin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2,5-dioxo-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrol-3-yl]quinazolin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57481642 |
| Molecular Formula | C27H26N6O4S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | tert-butyl 4-[4-[2,5-dioxo-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrol-3-yl]quinazolin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc(C3=C(c4c[nH]c5ccsc45)C(=O)NC3=O)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C27H26N6O4S/c1-27(2,3)37-26(36)33-11-9-32(10-12-33)25-29-17-7-5-4-6-15(17)21(30-25)20-19(23(34)31-24(20)35)16-14-28-18-8-13-38-22(16)18/h4-8,13-14,28H,9-12H2,1-3H3,(H,31,34,35) |
| InChIKey | MZPPXPITDAGJTO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|