C25H22N6O2 — CID 76973958
3-(1H-indol-3-yl)-4-[2-[4-(trideuterio(113C)methyl)piperazin-1-yl]quinazolin-4-yl]pyrrole-2,5-dione (PubChem CID 76973958) has the molecular formula C25H22N6O2 and a molecular weight of 442.50 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[2-[4-(trideuterio(113C)methyl)piperazin-1-yl]quinazolin-4-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-[2-[4-(trideuterio(113C)methyl)piperazin-1-yl]quinazolin-4-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 76973958 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[2-[4-(trideuterio(113C)methyl)piperazin-1-yl]quinazolin-4-yl]pyrrole-2,5-dione |
| SMILES | [2H][13C]([2H])([2H])N1CCN(c2nc(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C25H22N6O2/c1-30-10-12-31(13-11-30)25-27-19-9-5-3-7-16(19)22(28-25)21-20(23(32)29-24(21)33)17-14-26-18-8-4-2-6-15(17)18/h2-9,14,26H,10-13H2,1H3,(H,29,32,33)/i1+1D3 |
| InChIKey | OAVGBZOFDPFGPJ-KQORAOOSSA-N |
| XLogP | 2.43 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|