C25H24N6O2S — CID 53257465
3-(6H-thieno[2,3-b]pyrrol-4-yl)-4-[2-(3,3,4-trimethylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione (PubChem CID 53257465) has the molecular formula C25H24N6O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is 3-(6H-thieno[2,3-b]pyrrol-4-yl)-4-[2-(3,3,4-trimethylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione.
| Compound Name | 3-(6H-thieno[2,3-b]pyrrol-4-yl)-4-[2-(3,3,4-trimethylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 53257465 |
| Molecular Formula | C25H24N6O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-(6H-thieno[2,3-b]pyrrol-4-yl)-4-[2-(3,3,4-trimethylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione |
| SMILES | CN1CCN(c2nc(C3=C(c4c[nH]c5sccc45)C(=O)NC3=O)c3ccccc3n2)CC1(C)C |
| InChI | InChI=1S/C25H24N6O2S/c1-25(2)13-31(10-9-30(25)3)24-27-17-7-5-4-6-15(17)20(28-24)19-18(21(32)29-22(19)33)16-12-26-23-14(16)8-11-34-23/h4-8,11-12,26H,9-10,13H2,1-3H3,(H,29,32,33) |
| InChIKey | LGFRWOXGGPPPGW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|