C18H16N8O3 — CID 57498065
6-[[6-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-3-nitro-2-pyridinyl]amino]-1,2-dihydroindazol-3-one (PubChem CID 57498065) has the molecular formula C18H16N8O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 6-[[6-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-3-nitro-2-pyridinyl]amino]-1,2-dihydroindazol-3-one.
| Compound Name | 6-[[6-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-3-nitro-2-pyridinyl]amino]-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 57498065 |
| Molecular Formula | C18H16N8O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 6-[[6-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-3-nitro-2-pyridinyl]amino]-1,2-dihydroindazol-3-one |
| SMILES | O=c1[nH][nH]c2cc(Nc3nc(Nc4cc(C5CC5)[nH]n4)ccc3[N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C18H16N8O3/c27-18-11-4-3-10(7-13(11)23-25-18)19-17-14(26(28)29)5-6-15(21-17)20-16-8-12(22-24-16)9-1-2-9/h3-9H,1-2H2,(H2,23,25,27)(H3,19,20,21,22,24) |
| InChIKey | YWFMRDVKDLIGKV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 157.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|