C23H37N7O3 — CID 57499300
2-[[1-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]amino]-N,N-diethylacetamide (PubChem CID 57499300) has the molecular formula C23H37N7O3 and a molecular weight of 459.60 g/mol. Its IUPAC name is 2-[[1-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]amino]-N,N-diethylacetamide.
| Compound Name | 2-[[1-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 57499300 |
| Molecular Formula | C23H37N7O3 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | 2-[[1-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNC1CCCN(c2nc3c(c(=O)n(C)c(=O)n3C)n2CC=C(C)C)C1 |
| InChI | InChI=1S/C23H37N7O3/c1-7-28(8-2)18(31)14-24-17-10-9-12-29(15-17)22-25-20-19(30(22)13-11-16(3)4)21(32)27(6)23(33)26(20)5/h11,17,24H,7-10,12-15H2,1-6H3 |
| InChIKey | WVUYQOIEHGPUSR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|