C21H27NO4 — CID 577041
(4,6,10,10-tetramethylspiro[4.5]dec-6-en-4-yl) 4-nitrobenzoate (PubChem CID 577041) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (4,6,10,10-tetramethylspiro[4.5]dec-6-en-4-yl) 4-nitrobenzoate.
| Compound Name | (4,6,10,10-tetramethylspiro[4.5]dec-6-en-4-yl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 577041 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (4,6,10,10-tetramethylspiro[4.5]dec-6-en-4-yl) 4-nitrobenzoate |
| SMILES | CC1=CCCC(C)(C)C12CCCC2(C)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H27NO4/c1-15-7-5-12-19(2,3)21(15)14-6-13-20(21,4)26-18(23)16-8-10-17(11-9-16)22(24)25/h7-11H,5-6,12-14H2,1-4H3 |
| InChIKey | LIXYERDKJHHPJX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|