C11H13FN2S — CID 579067
N-(2-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine (PubChem CID 579067) has the molecular formula C11H13FN2S and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(2-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine.
| Compound Name | N-(2-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 579067 |
| Molecular Formula | C11H13FN2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-(2-fluorophenyl)-5,5-dimethyl-4H-1,3-thiazol-2-amine |
| SMILES | CC1(C)CN=C(Nc2ccccc2F)S1 |
| InChI | InChI=1S/C11H13FN2S/c1-11(2)7-13-10(15-11)14-9-6-4-3-5-8(9)12/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | GTLQUHPYIWENFW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |