About 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one
3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 579765) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one.
Analyze 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The IUPAC name of 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one (CID 579765) is 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one.
What is the SMILES notation for 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The canonical SMILES for 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one is NCc1noc2c1C(=O)CCC2.
What is the InChIKey of 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The InChIKey is XIPKEGGHPDPAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c9-4-5-8-6(11)2-1-3-7(8)12-10-5/h1-4,9H2.
What are the key properties of 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one?
3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one has a molecular weight of 166.18 g/mol, XLogP of 0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-6,7-dihydro-5H-1,2-benzoxazol-4-one is sourced from PubChem (CID 579765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).