C20H26O4 — CID 579871
methyl 7-ethenyl-3-hydroxy-4a,7-dimethyl-2-oxo-4b,5,6,8,10,10a-hexahydro-1H-phenanthrene-1-carboxylate (PubChem CID 579871) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is methyl 7-ethenyl-3-hydroxy-4a,7-dimethyl-2-oxo-4b,5,6,8,10,10a-hexahydro-1H-phenanthrene-1-carboxylate.
| Compound Name | methyl 7-ethenyl-3-hydroxy-4a,7-dimethyl-2-oxo-4b,5,6,8,10,10a-hexahydro-1H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 579871 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | methyl 7-ethenyl-3-hydroxy-4a,7-dimethyl-2-oxo-4b,5,6,8,10,10a-hexahydro-1H-phenanthrene-1-carboxylate |
| SMILES | C=CC1(C)CCC2C(=CCC3C(C(=O)OC)C(=O)C(O)=CC23C)C1 |
| InChI | InChI=1S/C20H26O4/c1-5-19(2)9-8-13-12(10-19)6-7-14-16(18(23)24-4)17(22)15(21)11-20(13,14)3/h5-6,11,13-14,16,21H,1,7-10H2,2-4H3 |
| InChIKey | ARWWFIBDNBUWPD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|