C25H31ClN2O7 — CID 58001931
(3S)-3-[(3-chloro-4-propoxybenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butaneperoxoic acid (PubChem CID 58001931) has the molecular formula C25H31ClN2O7 and a molecular weight of 506.98 g/mol. Its IUPAC name is (3S)-3-[(3-chloro-4-propoxybenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butaneperoxoic acid.
| Compound Name | (3S)-3-[(3-chloro-4-propoxybenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butaneperoxoic acid |
|---|---|
| PubChem CID | 58001931 |
| Molecular Formula | C25H31ClN2O7 |
| Molecular Weight | 506.98 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | (3S)-3-[(3-chloro-4-propoxybenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butaneperoxoic acid |
| SMILES | CCCOc1ccc(C(=O)N[C@H](CC(=O)OO)Cc2ccc(NC(=O)OC(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C25H31ClN2O7/c1-5-12-33-21-11-8-17(14-20(21)26)23(30)27-19(15-22(29)35-32)13-16-6-9-18(10-7-16)28-24(31)34-25(2,3)4/h6-11,14,19,32H,5,12-13,15H2,1-4H3,(H,27,30)(H,28,31)/t19-/m0/s1 |
| InChIKey | VZMVBOBOBGQHLE-IBGZPJMESA-N |
| XLogP | 5.22 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|