C25H9F9N2OPt — CID 58004277
(2,4-difluorobenzene-6-id-1-yl)-[6-[2,4-difluoro-3-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-2-ylbenzene-6-id-1-yl]-2-pyridinyl]methanone;platinum(2+) (PubChem CID 58004277) has the molecular formula C25H9F9N2OPt and a molecular weight of 719.42 g/mol. Its IUPAC name is (2,4-difluorobenzene-6-id-1-yl)-[6-[2,4-difluoro-3-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-2-ylbenzene-6-id-1-yl]-2-pyridinyl]methanone;platinum(2+).
| Compound Name | (2,4-difluorobenzene-6-id-1-yl)-[6-[2,4-difluoro-3-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-2-ylbenzene-6-id-1-yl]-2-pyridinyl]methanone;platinum(2+) |
|---|---|
| PubChem CID | 58004277 |
| Molecular Formula | C25H9F9N2OPt |
| Molecular Weight | 719.42 g/mol |
| Exact Mass | 719.02 |
| IUPAC Name | (2,4-difluorobenzene-6-id-1-yl)-[6-[2,4-difluoro-3-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-2-ylbenzene-6-id-1-yl]-2-pyridinyl]methanone;platinum(2+) |
| SMILES | O=C(c1cccc(-c2[c-]c(-c3ccccn3)c(F)c(C(F)(F)C(F)(F)F)c2F)n1)c1[c-]cc(F)cc1F.[Pt+2] |
| InChI | InChI=1S/C25H9F9N2O.Pt/c26-12-7-8-13(16(27)10-12)23(37)19-6-3-5-18(36-19)15-11-14(17-4-1-2-9-35-17)21(28)20(22(15)29)24(30,31)25(32,33)34;/h1-7,9-10H;/q-2;+2 |
| InChIKey | HHBFXXFYCQLXAB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.42 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|