C18H10F6IrN2O-2 — CID 59431405
iridium;2-phenylpyridine;2,2,2-trifluoro-1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone (PubChem CID 59431405) has the molecular formula C18H10F6IrN2O-2 and a molecular weight of 576.50 g/mol. Its IUPAC name is iridium;2-phenylpyridine;2,2,2-trifluoro-1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone.
| Compound Name | iridium;2-phenylpyridine;2,2,2-trifluoro-1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
|---|---|
| PubChem CID | 59431405 |
| Molecular Formula | C18H10F6IrN2O-2 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 577.03 |
| IUPAC Name | iridium;2-phenylpyridine;2,2,2-trifluoro-1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
| SMILES | O=C(c1cc(C(F)(F)F)c[n-]1)C(F)(F)F.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C7H3F6NO.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;8-6(9,10)3-1-4(14-2-3)5(15)7(11,12)13;/h1-6,8-9H;1-2H,(H,14,15);/q-1;;/p-1 |
| InChIKey | KBRWQSYUPFBOMT-UHFFFAOYSA-M |
| XLogP | 4.95 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|