C18H29F5O4 — CID 58004999
2,2,3,3,3-pentafluoropropyl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate (PubChem CID 58004999) has the molecular formula C18H29F5O4 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate |
|---|---|
| PubChem CID | 58004999 |
| Molecular Formula | C18H29F5O4 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate |
| SMILES | CCC(CC)(CCCC(=O)OCC(F)(F)C(F)(F)F)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C18H29F5O4/c1-6-15(4,5)14(25)27-16(7-2,8-3)11-9-10-13(24)26-12-17(19,20)18(21,22)23/h6-12H2,1-5H3 |
| InChIKey | DXERQERDCNAJTO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|