C38H49N3O5 — CID 58005702
tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(5-hydroxypent-1-ynyl)phenyl]piperidine-1-carboxylate (PubChem CID 58005702) has the molecular formula C38H49N3O5 and a molecular weight of 627.83 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(5-hydroxypent-1-ynyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(5-hydroxypent-1-ynyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58005702 |
| Molecular Formula | C38H49N3O5 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(5-hydroxypent-1-ynyl)phenyl]piperidine-1-carboxylate |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CN(C(=O)OC(C)(C)C)CC[C@@H]2c2cccc(C#CCCCO)c2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C38H49N3O5/c1-38(2,3)46-37(44)40-21-19-32(29-14-10-13-28(24-29)12-6-5-9-22-42)34(27-40)36(43)41(31-17-18-31)26-30-25-39(20-11-23-45-4)35-16-8-7-15-33(30)35/h7-8,10,13-16,24-25,31-32,34,42H,5,9,11,17-23,26-27H2,1-4H3/t32-,34+/m1/s1 |
| InChIKey | CBGFDSHEQPSWMF-CWTKIQHKSA-N |
| XLogP | 6.33 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|