C39H46N4O6 — CID 58006033
tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(4-nitrophenyl)phenyl]piperidine-1-carboxylate (PubChem CID 58006033) has the molecular formula C39H46N4O6 and a molecular weight of 666.82 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(4-nitrophenyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(4-nitrophenyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58006033 |
| Molecular Formula | C39H46N4O6 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.34 |
| IUPAC Name | tert-butyl (3R,4S)-3-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]-4-[3-(4-nitrophenyl)phenyl]piperidine-1-carboxylate |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CN(C(=O)OC(C)(C)C)CC[C@@H]2c2cccc(-c3ccc([N+](=O)[O-])cc3)c2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C39H46N4O6/c1-39(2,3)49-38(45)41-21-19-33(29-10-7-9-28(23-29)27-13-15-32(16-14-27)43(46)47)35(26-41)37(44)42(31-17-18-31)25-30-24-40(20-8-22-48-4)36-12-6-5-11-34(30)36/h5-7,9-16,23-24,31,33,35H,8,17-22,25-26H2,1-4H3/t33-,35+/m1/s1 |
| InChIKey | ROPCPCPLSSIPBJ-OQBISYOISA-N |
| XLogP | 7.78 |
| TPSA | 107.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|