C40H48FN3O4 — CID 143253646
(3R,4S)-N-cyclopropyl-4-[3-(3-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-1-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]piperidine-3-carboxamide (PubChem CID 143253646) has the molecular formula C40H48FN3O4 and a molecular weight of 653.84 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-4-[3-(3-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-1-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-cyclopropyl-4-[3-(3-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-1-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 143253646 |
| Molecular Formula | C40H48FN3O4 |
| Molecular Weight | 653.84 g/mol |
| Exact Mass | 653.36 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-4-[3-(3-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-1-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CN(C3(OC(C)(C)C)CO3)CC[C@@H]2c2cccc(-c3cccc(F)c3)c2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C40H48FN3O4/c1-39(2,3)48-40(27-47-40)43-20-18-34(30-12-7-10-28(22-30)29-11-8-13-32(41)23-29)36(26-43)38(45)44(33-16-17-33)25-31-24-42(19-9-21-46-4)37-15-6-5-14-35(31)37/h5-8,10-15,22-24,33-34,36H,9,16-21,25-27H2,1-4H3/t34-,36+,40?/m1/s1 |
| InChIKey | AEJRQUSSVFWLHD-BDMPXECUSA-N |
| XLogP | 7.58 |
| TPSA | 59.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.84 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|