C29H31Cl2N3O3S — CID 58007024
ethyl (2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethylpyrrolidine-2-carboxylate (PubChem CID 58007024) has the molecular formula C29H31Cl2N3O3S and a molecular weight of 572.56 g/mol. Its IUPAC name is ethyl (2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58007024 |
| Molecular Formula | C29H31Cl2N3O3S |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | ethyl (2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H](CC)N1C(=O)C1=C(C)N2C(=N[C@@](C)(c3ccc(Cl)cc3)[C@H]2c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C29H31Cl2N3O3S/c1-5-22-15-16-23(27(36)37-6-2)34(22)26(35)24-17(3)33-25(18-7-11-20(30)12-8-18)29(4,32-28(33)38-24)19-9-13-21(31)14-10-19/h7-14,22-23,25H,5-6,15-16H2,1-4H3/t22-,23+,25-,29+/m1/s1 |
| InChIKey | MXERZOZVLMXELQ-BGLPIVGWSA-N |
| XLogP | 6.93 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |