C27H27F3O6 — CID 58007651
ethyl 2-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenoxy]phenoxy]acetate (PubChem CID 58007651) has the molecular formula C27H27F3O6 and a molecular weight of 504.50 g/mol. Its IUPAC name is ethyl 2-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenoxy]phenoxy]acetate.
| Compound Name | ethyl 2-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 58007651 |
| Molecular Formula | C27H27F3O6 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | ethyl 2-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenoxy]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Oc2ccc(OC(F)(F)F)cc2)ccc1OCCCCc1ccccc1 |
| InChI | InChI=1S/C27H27F3O6/c1-2-32-26(31)19-34-25-18-23(35-21-11-13-22(14-12-21)36-27(28,29)30)15-16-24(25)33-17-7-6-10-20-8-4-3-5-9-20/h3-5,8-9,11-16,18H,2,6-7,10,17,19H2,1H3 |
| InChIKey | OKWFLHFNSBRGID-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|