C23H25N5OY-2 — CID 58011144
1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-(1H-indol-5-yl)urea;carbanide;yttrium (PubChem CID 58011144) has the molecular formula C23H25N5OY-2 and a molecular weight of 476.39 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-(1H-indol-5-yl)urea;carbanide;yttrium.
| Compound Name | 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-(1H-indol-5-yl)urea;carbanide;yttrium |
|---|---|
| PubChem CID | 58011144 |
| Molecular Formula | C23H25N5OY-2 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 1-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-(1H-indol-5-yl)urea;carbanide;yttrium |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc3[nH]ccc3c2)n(-c2cc[c-]cc2)n1.[CH3-].[Y] |
| InChI | InChI=1S/C22H22N5O.CH3.Y/c1-22(2,3)19-14-20(27(26-19)17-7-5-4-6-8-17)25-21(28)24-16-9-10-18-15(13-16)11-12-23-18;;/h5-14,23H,1-3H3,(H2,24,25,28);1H3;/q2*-1; |
| InChIKey | CTRZDDDOXJUDFE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|