C21H27FN2O — CID 58011431
N-(1-bicyclo[2.2.2]octanylmethyl)-4-fluoro-1-propan-2-ylindole-3-carboxamide (PubChem CID 58011431) has the molecular formula C21H27FN2O and a molecular weight of 342.46 g/mol. Its IUPAC name is N-(1-bicyclo[2.2.2]octanylmethyl)-4-fluoro-1-propan-2-ylindole-3-carboxamide.
| Compound Name | N-(1-bicyclo[2.2.2]octanylmethyl)-4-fluoro-1-propan-2-ylindole-3-carboxamide |
|---|---|
| PubChem CID | 58011431 |
| Molecular Formula | C21H27FN2O |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-(1-bicyclo[2.2.2]octanylmethyl)-4-fluoro-1-propan-2-ylindole-3-carboxamide |
| SMILES | CC(C)n1cc(C(=O)NCC23CCC(CC2)CC3)c2c(F)cccc21 |
| InChI | InChI=1S/C21H27FN2O/c1-14(2)24-12-16(19-17(22)4-3-5-18(19)24)20(25)23-13-21-9-6-15(7-10-21)8-11-21/h3-5,12,14-15H,6-11,13H2,1-2H3,(H,23,25) |
| InChIKey | COYQHIFNINNPDR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |