C24H29BN2O3 — CID 89283438
CID 89283438 (PubChem CID 89283438) has the molecular formula C24H29BN2O3 and a molecular weight of 404.32 g/mol.
| Compound Name | CID 89283438 |
|---|---|
| PubChem CID | 89283438 |
| Molecular Formula | C24H29BN2O3 |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1c(C(=O)NCC13CC4CC(CC(C4)C1)C3)cn2CC1(O)COC1 |
| InChI | InChI=1S/C24H29BN2O3/c25-19-2-1-3-20-21(19)18(10-27(20)12-24(29)13-30-14-24)22(28)26-11-23-7-15-4-16(8-23)6-17(5-15)9-23/h1-3,10,15-17,29H,4-9,11-14H2,(H,26,28) |
| InChIKey | KIEAHZUHFLHFHZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|