C21H25BN6O — CID 89150545
CID 89150545 (PubChem CID 89150545) has the molecular formula C21H25BN6O and a molecular weight of 388.28 g/mol.
| Compound Name | CID 89150545 |
|---|---|
| PubChem CID | 89150545 |
| Molecular Formula | C21H25BN6O |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1c(C(=O)NCC13CCC(CC1)CC3)cn2CCc1nn[nH]n1 |
| InChI | InChI=1S/C21H25BN6O/c22-16-2-1-3-17-19(16)15(12-28(17)11-7-18-24-26-27-25-18)20(29)23-13-21-8-4-14(5-9-21)6-10-21/h1-3,12,14H,4-11,13H2,(H,23,29)(H,24,25,26,27) |
| InChIKey | OQJXUCUHOYJOPK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|