C9H6F2N2O — CID 58015534
5-(5,6-difluoro-3-pyridinyl)-3-methyl-1,2-oxazole (PubChem CID 58015534) has the molecular formula C9H6F2N2O and a molecular weight of 196.16 g/mol. Its IUPAC name is 5-(5,6-difluoro-3-pyridinyl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(5,6-difluoro-3-pyridinyl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 58015534 |
| Molecular Formula | C9H6F2N2O |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 5-(5,6-difluoro-3-pyridinyl)-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2cnc(F)c(F)c2)on1 |
| InChI | InChI=1S/C9H6F2N2O/c1-5-2-8(14-13-5)6-3-7(10)9(11)12-4-6/h2-4H,1H3 |
| InChIKey | JILBJRGKNUEJEP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|