C19H21N2O5- — CID 58019898
5-(hydroxymethyl)-1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one (PubChem CID 58019898) has the molecular formula C19H21N2O5- and a molecular weight of 357.39 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one.
| Compound Name | 5-(hydroxymethyl)-1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 58019898 |
| Molecular Formula | C19H21N2O5- |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 5-(hydroxymethyl)-1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)CCC2CO)cc1-c1cccc(N([O-])O)c1 |
| InChI | InChI=1S/C19H21N2O5/c1-26-18-7-5-13(11-20-16(12-22)6-8-19(20)23)9-17(18)14-3-2-4-15(10-14)21(24)25/h2-5,7,9-10,16,22,24H,6,8,11-12H2,1H3/q-1 |
| InChIKey | LSDXBLIVLGAYLF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|