C19H19N5O4 — CID 58020029
(5S)-5-(azidomethyl)-1-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 58020029) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is (5S)-5-(azidomethyl)-1-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-(azidomethyl)-1-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 58020029 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (5S)-5-(azidomethyl)-1-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)CC[C@H]2CN=[N+]=[N-])cc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N5O4/c1-28-18-7-5-13(12-23-16(11-21-22-20)6-8-19(23)25)9-17(18)14-3-2-4-15(10-14)24(26)27/h2-5,7,9-10,16H,6,8,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | RGDXADOESUFNHB-INIZCTEOSA-N |
| XLogP | 4.07 |
| TPSA | 121.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|