C18H19N2O4- — CID 88611873
1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one (PubChem CID 88611873) has the molecular formula C18H19N2O4- and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 88611873 |
| Molecular Formula | C18H19N2O4- |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[[3-[3-[hydroxy(oxido)amino]phenyl]-4-methoxyphenyl]methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2CCCC2=O)cc1-c1cccc(N([O-])O)c1 |
| InChI | InChI=1S/C18H19N2O4/c1-24-17-8-7-13(12-19-9-3-6-18(19)21)10-16(17)14-4-2-5-15(11-14)20(22)23/h2,4-5,7-8,10-11,22H,3,6,9,12H2,1H3/q-1 |
| InChIKey | OYWXAASNZAKORQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|