C17H17N2O5- — CID 58019979
2-[3-(dihydroxyamino)phenyl]-3-hydroxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate (PubChem CID 58019979) has the molecular formula C17H17N2O5- and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-[3-(dihydroxyamino)phenyl]-3-hydroxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate.
| Compound Name | 2-[3-(dihydroxyamino)phenyl]-3-hydroxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate |
|---|---|
| PubChem CID | 58019979 |
| Molecular Formula | C17H17N2O5- |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[3-(dihydroxyamino)phenyl]-3-hydroxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate |
| SMILES | O=C1CCCN1Cc1ccc(O)c(-c2cccc(N(O)O)c2)c1[O-] |
| InChI | InChI=1S/C17H18N2O5/c20-14-7-6-12(10-18-8-2-5-15(18)21)17(22)16(14)11-3-1-4-13(9-11)19(23)24/h1,3-4,6-7,9,20,22-24H,2,5,8,10H2/p-1 |
| InChIKey | RXMAJMISDWAUFZ-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|