C18H19N2O5- — CID 58020241
2-[3-(dihydroxyamino)phenyl]-3-methoxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate (PubChem CID 58020241) has the molecular formula C18H19N2O5- and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-[3-(dihydroxyamino)phenyl]-3-methoxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate.
| Compound Name | 2-[3-(dihydroxyamino)phenyl]-3-methoxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate |
|---|---|
| PubChem CID | 58020241 |
| Molecular Formula | C18H19N2O5- |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-[3-(dihydroxyamino)phenyl]-3-methoxy-6-[(2-oxopyrrolidin-1-yl)methyl]phenolate |
| SMILES | COc1ccc(CN2CCCC2=O)c([O-])c1-c1cccc(N(O)O)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-25-15-8-7-13(11-19-9-3-6-16(19)21)18(22)17(15)12-4-2-5-14(10-12)20(23)24/h2,4-5,7-8,10,22-24H,3,6,9,11H2,1H3/p-1 |
| InChIKey | JVJRHMBASNVZOY-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|