C25H35N5O2+2 — CID 58023777
[3-(1-adamantylcarbamoyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methyl-methyl-[(5-oxopyrrolidin-3-yl)methyl]azanium (PubChem CID 58023777) has the molecular formula C25H35N5O2+2 and a molecular weight of 437.59 g/mol. Its IUPAC name is [3-(1-adamantylcarbamoyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methyl-methyl-[(5-oxopyrrolidin-3-yl)methyl]azanium.
| Compound Name | [3-(1-adamantylcarbamoyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methyl-methyl-[(5-oxopyrrolidin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 58023777 |
| Molecular Formula | C25H35N5O2+2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [3-(1-adamantylcarbamoyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methyl-methyl-[(5-oxopyrrolidin-3-yl)methyl]azanium |
| SMILES | C[NH+](Cc1[nH]c(C(=O)NC23CC4CC(CC(C4)C2)C3)[n+]2ccccc12)CC1CNC(=O)C1 |
| InChI | InChI=1S/C25H33N5O2/c1-29(14-19-9-22(31)26-13-19)15-20-21-4-2-3-5-30(21)23(27-20)24(32)28-25-10-16-6-17(11-25)8-18(7-16)12-25/h2-5,16-19H,6-15H2,1H3,(H2,26,28,31,32)/p+2 |
| InChIKey | OUTZTZXHOKCGQZ-UHFFFAOYSA-P |
| XLogP | 0.60 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|