C19H21ClN4O2+2 — CID 58023816
N-[(3-chlorophenyl)methyl]-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023816) has the molecular formula C19H21ClN4O2+2 and a molecular weight of 372.86 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023816 |
| Molecular Formula | C19H21ClN4O2+2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-morpholin-4-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1[nH]c([NH+]2CCOCC2)[n+]2ccccc12 |
| InChI | InChI=1S/C19H19ClN4O2/c20-15-5-3-4-14(12-15)13-21-18(25)17-16-6-1-2-7-24(16)19(22-17)23-8-10-26-11-9-23/h1-7,12H,8-11,13H2,(H,21,25)/p+2 |
| InChIKey | NXVPRWSUAJAWNR-UHFFFAOYSA-P |
| XLogP | 0.88 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|