C20H18ClN5O+2 — CID 58023309
3-(3-chlorophenyl)-N-[(5-methylpyrazin-1-ium-2-yl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023309) has the molecular formula C20H18ClN5O+2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[(5-methylpyrazin-1-ium-2-yl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | 3-(3-chlorophenyl)-N-[(5-methylpyrazin-1-ium-2-yl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023309 |
| Molecular Formula | C20H18ClN5O+2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[(5-methylpyrazin-1-ium-2-yl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | Cc1c[nH+]c(CNC(=O)c2[nH]c(-c3cccc(Cl)c3)[n+]3ccccc23)cn1 |
| InChI | InChI=1S/C20H16ClN5O/c1-13-10-23-16(11-22-13)12-24-20(27)18-17-7-2-3-8-26(17)19(25-18)14-5-4-6-15(21)9-14/h2-11H,12H2,1H3,(H,24,27)/p+2 |
| InChIKey | HEPFABMXFDJNJF-UHFFFAOYSA-P |
| XLogP | 2.52 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|