C23H19ClN3O+ — CID 58023569
1-(3-chlorophenyl)-N-(2,3-dihydro-1H-inden-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023569) has the molecular formula C23H19ClN3O+ and a molecular weight of 388.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(2,3-dihydro-1H-inden-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(2,3-dihydro-1H-inden-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023569 |
| Molecular Formula | C23H19ClN3O+ |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(2,3-dihydro-1H-inden-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1[nH]c(-c2cccc(Cl)c2)c2cccc[n+]12 |
| InChI | InChI=1S/C23H18ClN3O/c24-18-9-5-8-17(12-18)21-20-10-3-4-11-27(20)22(26-21)23(28)25-19-13-15-6-1-2-7-16(15)14-19/h1-12,19H,13-14H2,(H,25,28)/p+1 |
| InChIKey | WBLYQOFLHDQTAG-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|