C25H21ClF3N4O+ — CID 163807955
N-[1-(1,2,3,3a-tetrahydrocyclohepta[b]pyrrol-8-yl)-2,2,2-trifluoroethyl]-1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 163807955) has the molecular formula C25H21ClF3N4O+ and a molecular weight of 485.92 g/mol. Its IUPAC name is N-[1-(1,2,3,3a-tetrahydrocyclohepta[b]pyrrol-8-yl)-2,2,2-trifluoroethyl]-1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | N-[1-(1,2,3,3a-tetrahydrocyclohepta[b]pyrrol-8-yl)-2,2,2-trifluoroethyl]-1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 163807955 |
| Molecular Formula | C25H21ClF3N4O+ |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[1-(1,2,3,3a-tetrahydrocyclohepta[b]pyrrol-8-yl)-2,2,2-trifluoroethyl]-1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | O=C(NC(C1=C2NCCC2C=CC=C1)C(F)(F)F)c1[nH]c(-c2cccc(Cl)c2)c2cccc[n+]12 |
| InChI | InChI=1S/C25H20ClF3N4O/c26-17-8-5-7-16(14-17)21-19-10-3-4-13-33(19)23(31-21)24(34)32-22(25(27,28)29)18-9-2-1-6-15-11-12-30-20(15)18/h1-10,13-15,22,30H,11-12H2,(H,32,34)/p+1 |
| InChIKey | NKRNLYFBXGLUHK-UHFFFAOYSA-O |
| XLogP | 4.72 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|