C21H15ClF3N4O+ — CID 58023266
3-(2-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023266) has the molecular formula C21H15ClF3N4O+ and a molecular weight of 431.83 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023266 |
| Molecular Formula | C21H15ClF3N4O+ |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | O=C(NC(c1ccccn1)C(F)(F)F)c1[nH]c(-c2ccccc2Cl)[n+]2ccccc12 |
| InChI | InChI=1S/C21H14ClF3N4O/c22-14-8-2-1-7-13(14)19-27-17(16-10-4-6-12-29(16)19)20(30)28-18(21(23,24)25)15-9-3-5-11-26-15/h1-12,18H,(H,28,30)/p+1 |
| InChIKey | BELNACRCQJENKX-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|