C15H10ClF4N4O+ — CID 58023999
1-chloro-8-fluoro-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023999) has the molecular formula C15H10ClF4N4O+ and a molecular weight of 373.72 g/mol. Its IUPAC name is 1-chloro-8-fluoro-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | 1-chloro-8-fluoro-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023999 |
| Molecular Formula | C15H10ClF4N4O+ |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-chloro-8-fluoro-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | O=C(NC(c1ccccn1)C(F)(F)F)c1[nH]c(Cl)c2c(F)ccc[n+]12 |
| InChI | InChI=1S/C15H9ClF4N4O/c16-12-10-8(17)4-3-7-24(10)13(23-12)14(25)22-11(15(18,19)20)9-5-1-2-6-21-9/h1-7,11H,(H,22,25)/p+1 |
| InChIKey | BJVMTTTZUZJYTA-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|