C25H15Cl2F9N4O5 — CID 87652313
3-(2,4-dichlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87652313) has the molecular formula C25H15Cl2F9N4O5 and a molecular weight of 693.31 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 3-(2,4-dichlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87652313 |
| Molecular Formula | C25H15Cl2F9N4O5 |
| Molecular Weight | 693.31 g/mol |
| Exact Mass | 692.03 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | O=C(NC(c1cccc[nH+]1)C(F)(F)F)c1[nH]c(-c2ccc(Cl)cc2Cl)[n+]2ccccc12.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C21H13Cl2F3N4O.2C2HF3O2/c22-12-7-8-13(14(23)11-12)19-28-17(16-6-2-4-10-30(16)19)20(31)29-18(21(24,25)26)15-5-1-3-9-27-15;2*3-2(4,5)1(6)7/h1-11,18H,(H,29,31);2*(H,6,7) |
| InChIKey | VKBIHHMUCLYNSU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|