C27H22F6N4O5 — CID 87652513
1-pyridin-1-ium-4-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87652513) has the molecular formula C27H22F6N4O5 and a molecular weight of 596.48 g/mol. Its IUPAC name is 1-pyridin-1-ium-4-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 1-pyridin-1-ium-4-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87652513 |
| Molecular Formula | C27H22F6N4O5 |
| Molecular Weight | 596.48 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 1-pyridin-1-ium-4-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | O=C(NC1CCCc2ccccc21)c1[nH]c(-c2cc[nH+]cc2)c2cccc[n+]12.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H20N4O.2C2HF3O2/c28-23(25-19-9-5-7-16-6-1-2-8-18(16)19)22-26-21(17-11-13-24-14-12-17)20-10-3-4-15-27(20)22;2*3-2(4,5)1(6)7/h1-4,6,8,10-15,19H,5,7,9H2,(H,25,28);2*(H,6,7) |
| InChIKey | FTVUZRSGVGWBJU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|