C21H16ClF3N4O+2 — CID 58023303
3-(3-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023303) has the molecular formula C21H16ClF3N4O+2 and a molecular weight of 432.83 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | 3-(3-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023303 |
| Molecular Formula | C21H16ClF3N4O+2 |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | O=C(NC(c1cccc[nH+]1)C(F)(F)F)c1[nH]c(-c2cccc(Cl)c2)[n+]2ccccc12 |
| InChI | InChI=1S/C21H14ClF3N4O/c22-14-7-5-6-13(12-14)19-27-17(16-9-2-4-11-29(16)19)20(30)28-18(21(23,24)25)15-8-1-3-10-26-15/h1-12,18H,(H,28,30)/p+2 |
| InChIKey | HFLKRRVCBNJCPI-UHFFFAOYSA-P |
| XLogP | 3.92 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|