C20H21ClN3O2+ — CID 58023825
[1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-(2,6-dimethylmorpholin-4-yl)methanone (PubChem CID 58023825) has the molecular formula C20H21ClN3O2+ and a molecular weight of 370.86 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-(2,6-dimethylmorpholin-4-yl)methanone.
| Compound Name | [1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 58023825 |
| Molecular Formula | C20H21ClN3O2+ |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2[nH]c(-c3cccc(Cl)c3)c3cccc[n+]23)CC(C)O1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-13-11-23(12-14(2)26-13)20(25)19-22-18(15-6-5-7-16(21)10-15)17-8-3-4-9-24(17)19/h3-10,13-14H,11-12H2,1-2H3/p+1 |
| InChIKey | QITJRWUUPYUHDX-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 49.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|