C21H25ClN3O+ — CID 58023873
1-[1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-2-[[(2R)-3,3-dimethylbutan-2-yl]amino]ethanone (PubChem CID 58023873) has the molecular formula C21H25ClN3O+ and a molecular weight of 370.90 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-2-[[(2R)-3,3-dimethylbutan-2-yl]amino]ethanone.
| Compound Name | 1-[1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-2-[[(2R)-3,3-dimethylbutan-2-yl]amino]ethanone |
|---|---|
| PubChem CID | 58023873 |
| Molecular Formula | C21H25ClN3O+ |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-3-yl]-2-[[(2R)-3,3-dimethylbutan-2-yl]amino]ethanone |
| SMILES | C[C@@H](NCC(=O)c1[nH]c(-c2cccc(Cl)c2)c2cccc[n+]12)C(C)(C)C |
| InChI | InChI=1S/C21H24ClN3O/c1-14(21(2,3)4)23-13-18(26)20-24-19(15-8-7-9-16(22)12-15)17-10-5-6-11-25(17)20/h5-12,14,23H,13H2,1-4H3/p+1/t14-/m1/s1 |
| InChIKey | JLCHRRBBKQPREK-CQSZACIVSA-O |
| XLogP | 4.28 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|