C20H23ClN3O+ — CID 58024028
1-(3-chlorophenyl)-N-(3,3-dimethylbutan-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58024028) has the molecular formula C20H23ClN3O+ and a molecular weight of 356.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(3,3-dimethylbutan-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(3,3-dimethylbutan-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58024028 |
| Molecular Formula | C20H23ClN3O+ |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(3,3-dimethylbutan-2-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | CC(NC(=O)c1[nH]c(-c2cccc(Cl)c2)c2cccc[n+]12)C(C)(C)C |
| InChI | InChI=1S/C20H22ClN3O/c1-13(20(2,3)4)22-19(25)18-23-17(14-8-7-9-15(21)12-14)16-10-5-6-11-24(16)18/h5-13H,1-4H3,(H,22,25)/p+1 |
| InChIKey | AGHOWRUHBXGAHE-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|