C16H13ClINO — CID 104693585
5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-2-iodobenzamide (PubChem CID 104693585) has the molecular formula C16H13ClINO and a molecular weight of 397.64 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-2-iodobenzamide.
| Compound Name | 5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 104693585 |
| Molecular Formula | C16H13ClINO |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 5-chloro-N-(2,3-dihydro-1H-inden-2-yl)-2-iodobenzamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C16H13ClINO/c17-12-5-6-15(18)14(9-12)16(20)19-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13H,7-8H2,(H,19,20) |
| InChIKey | YPHGBMLIVGXQTC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|