C13H16ClIN2O — CID 47219742
5-chloro-2-iodo-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 47219742) has the molecular formula C13H16ClIN2O and a molecular weight of 378.64 g/mol. Its IUPAC name is 5-chloro-2-iodo-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 5-chloro-2-iodo-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 47219742 |
| Molecular Formula | C13H16ClIN2O |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 5-chloro-2-iodo-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CN1CCC(NC(=O)c2cc(Cl)ccc2I)CC1 |
| InChI | InChI=1S/C13H16ClIN2O/c1-17-6-4-10(5-7-17)16-13(18)11-8-9(14)2-3-12(11)15/h2-3,8,10H,4-7H2,1H3,(H,16,18) |
| InChIKey | PVTJVLXCSPXJBS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|