C25H24N2O8 — CID 58025094
(1R,13S,15S,16R)-5,15-dihydroxy-21-methoxy-6,13,20,24-tetramethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-2,4(12),5,7(11),18(23),20-hexaene-17,19,22-trione (PubChem CID 58025094) has the molecular formula C25H24N2O8 and a molecular weight of 480.47 g/mol. Its IUPAC name is (1R,13S,15S,16R)-5,15-dihydroxy-21-methoxy-6,13,20,24-tetramethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-2,4(12),5,7(11),18(23),20-hexaene-17,19,22-trione.
| Compound Name | (1R,13S,15S,16R)-5,15-dihydroxy-21-methoxy-6,13,20,24-tetramethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-2,4(12),5,7(11),18(23),20-hexaene-17,19,22-trione |
|---|---|
| PubChem CID | 58025094 |
| Molecular Formula | C25H24N2O8 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (1R,13S,15S,16R)-5,15-dihydroxy-21-methoxy-6,13,20,24-tetramethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-2,4(12),5,7(11),18(23),20-hexaene-17,19,22-trione |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)[C@@H]1C3=Cc4c(O)c(C)c5c(c4[C@H](C)N3[C@@H](O)[C@H](C2=O)N1C)OCO5 |
| InChI | InChI=1S/C25H24N2O8/c1-8-18(28)11-6-12-16-14-15(19(29)9(2)22(33-5)21(14)31)20(30)17(26(16)4)25(32)27(12)10(3)13(11)24-23(8)34-7-35-24/h6,10,16-17,25,28,32H,7H2,1-5H3/t10-,16-,17-,25-/m0/s1 |
| InChIKey | OOPPDJNCACGWAF-JRDFTYHHSA-N |
| XLogP | 1.10 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|