C25H30N2O5 — CID 102471735
(1S,10R,13R)-5,8,16,19-tetramethoxy-10,21-dimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4,6,8,15,17,19-heptaen-12-ol (PubChem CID 102471735) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is (1S,10R,13R)-5,8,16,19-tetramethoxy-10,21-dimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4,6,8,15,17,19-heptaen-12-ol.
| Compound Name | (1S,10R,13R)-5,8,16,19-tetramethoxy-10,21-dimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4,6,8,15,17,19-heptaen-12-ol |
|---|---|
| PubChem CID | 102471735 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (1S,10R,13R)-5,8,16,19-tetramethoxy-10,21-dimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4,6,8,15,17,19-heptaen-12-ol |
| SMILES | COc1ccc(OC)c2c1C=C1[C@@H]3c4c(OC)ccc(OC)c4C[C@H](C(O)N1[C@@H]2C)N3C |
| InChI | InChI=1S/C25H30N2O5/c1-13-22-14(18(29-3)7-9-20(22)31-5)11-16-24-23-15(19(30-4)8-10-21(23)32-6)12-17(26(24)2)25(28)27(13)16/h7-11,13,17,24-25,28H,12H2,1-6H3/t13-,17-,24-,25?/m1/s1 |
| InChIKey | UARLRORUZJETHY-OZMXCFOLSA-N |
| XLogP | 3.37 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |