C12H14O3 — CID 101157510
(2S)-5,8-dimethoxy-1,2-dihydronaphthalen-2-ol (PubChem CID 101157510) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S)-5,8-dimethoxy-1,2-dihydronaphthalen-2-ol.
| Compound Name | (2S)-5,8-dimethoxy-1,2-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 101157510 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2S)-5,8-dimethoxy-1,2-dihydronaphthalen-2-ol |
| SMILES | COc1ccc(OC)c2c1C=C[C@@H](O)C2 |
| InChI | InChI=1S/C12H14O3/c1-14-11-5-6-12(15-2)10-7-8(13)3-4-9(10)11/h3-6,8,13H,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | NVILRSXMLUJMCQ-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |