C26H40N6O10S — CID 24838578
bis(2-(3-hydroxy-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)guanidine);sulfuric acid (PubChem CID 24838578) has the molecular formula C26H40N6O10S and a molecular weight of 628.71 g/mol. Its IUPAC name is bis(2-(3-hydroxy-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)guanidine);sulfuric acid.
| Compound Name | bis(2-(3-hydroxy-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)guanidine);sulfuric acid |
|---|---|
| PubChem CID | 24838578 |
| Molecular Formula | C26H40N6O10S |
| Molecular Weight | 628.71 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | bis(2-(3-hydroxy-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)guanidine);sulfuric acid |
| SMILES | COc1ccc(OC)c2c1CC(O)C(N=C(N)N)C2.COc1ccc(OC)c2c1CC(O)C(N=C(N)N)C2.O=S(=O)(O)O |
| InChI | InChI=1S/2C13H19N3O3.H2O4S/c2*1-18-11-3-4-12(19-2)8-6-10(17)9(5-7(8)11)16-13(14)15;1-5(2,3)4/h2*3-4,9-10,17H,5-6H2,1-2H3,(H4,14,15,16);(H2,1,2,3,4) |
| InChIKey | HEFODDYRLRPIDE-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 280.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.71 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|