C28H29N3O7 — CID 58025190
[(1R,10R,12R,13S)-12-cyano-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),6,15(20),16,18-hexaen-10-yl]methyl acetate (PubChem CID 58025190) has the molecular formula C28H29N3O7 and a molecular weight of 519.55 g/mol. Its IUPAC name is [(1R,10R,12R,13S)-12-cyano-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),6,15(20),16,18-hexaen-10-yl]methyl acetate.
| Compound Name | [(1R,10R,12R,13S)-12-cyano-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),6,15(20),16,18-hexaen-10-yl]methyl acetate |
|---|---|
| PubChem CID | 58025190 |
| Molecular Formula | C28H29N3O7 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [(1R,10R,12R,13S)-12-cyano-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),6,15(20),16,18-hexaen-10-yl]methyl acetate |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)[C@H](COC(C)=O)N1C(=C2)[C@H]2c3c(cc(C)c(OC)c3O)C[C@@H]([C@@H]1C#N)N2C |
| InChI | InChI=1S/C28H29N3O7/c1-12-7-15-8-17-19(10-29)31-18(23(30(17)4)21(15)25(34)27(12)36-5)9-16-22(20(31)11-38-14(3)32)26(35)28(37-6)13(2)24(16)33/h7,9,17,19-20,23,34H,8,11H2,1-6H3/t17-,19-,20-,23-/m0/s1 |
| InChIKey | NLGHLFZCAUBBAJ-UDSSINMLSA-N |
| XLogP | 2.01 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|